C22H20N4O6S — CID 154004789
(6R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154004789) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is (6R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154004789 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (6R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N[C@@H](C(=O)NC1C(=O)N2C(C(=O)O)=CC(Cc3ccc([N+](=O)[O-])cc3)S[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C22H20N4O6S/c23-17(13-4-2-1-3-5-13)19(27)24-18-20(28)25-16(22(29)30)11-15(33-21(18)25)10-12-6-8-14(9-7-12)26(31)32/h1-9,11,15,17-18,21H,10,23H2,(H,24,27)(H,29,30)/t15?,17-,18?,21-/m1/s1 |
| InChIKey | SLWHAGSSHADYGL-OYMMLTSBSA-N |
| XLogP | 1.57 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|