C18H16BrN3O7S — CID 154004955
(6R)-7-[(4-bromo-3-oxobutanoyl)amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154004955) has the molecular formula C18H16BrN3O7S and a molecular weight of 498.31 g/mol. Its IUPAC name is (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154004955 |
| Molecular Formula | C18H16BrN3O7S |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(CBr)CC(=O)NC1C(=O)N2C(C(=O)O)=CC(Cc3ccc([N+](=O)[O-])cc3)S[C@H]12 |
| InChI | InChI=1S/C18H16BrN3O7S/c19-8-11(23)6-14(24)20-15-16(25)21-13(18(26)27)7-12(30-17(15)21)5-9-1-3-10(4-2-9)22(28)29/h1-4,7,12,15,17H,5-6,8H2,(H,20,24)(H,26,27)/t12?,15?,17-/m1/s1 |
| InChIKey | JXYNUHUAKIFWKQ-MWHAMWOXSA-N |
| XLogP | 1.23 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|