C17H16BrN3O5S — CID 88766725
4-bromo-N-[(6S)-7-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-3-oxobutanamide (PubChem CID 88766725) has the molecular formula C17H16BrN3O5S and a molecular weight of 454.30 g/mol. Its IUPAC name is 4-bromo-N-[(6S)-7-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-3-oxobutanamide.
| Compound Name | 4-bromo-N-[(6S)-7-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-3-oxobutanamide |
|---|---|
| PubChem CID | 88766725 |
| Molecular Formula | C17H16BrN3O5S |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 4-bromo-N-[(6S)-7-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-3-oxobutanamide |
| SMILES | O=C(CBr)CC(=O)NC1(Cc2ccc([N+](=O)[O-])cc2)C(=O)N2C=CCS[C@H]21 |
| InChI | InChI=1S/C17H16BrN3O5S/c18-10-13(22)8-14(23)19-17(15(24)20-6-1-7-27-16(17)20)9-11-2-4-12(5-3-11)21(25)26/h1-6,16H,7-10H2,(H,19,23)/t16-,17?/m0/s1 |
| InChIKey | GWMMEOPZXSGEKG-BHWOMJMDSA-N |
| XLogP | 1.78 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|