C21H17Br2N3O7S — CID 22798936
(4-nitrophenyl)methyl (6S)-7-[[2-(5-bromofuran-2-yl)acetyl]amino]-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22798936) has the molecular formula C21H17Br2N3O7S and a molecular weight of 615.26 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-7-[[2-(5-bromofuran-2-yl)acetyl]amino]-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-7-[[2-(5-bromofuran-2-yl)acetyl]amino]-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22798936 |
| Molecular Formula | C21H17Br2N3O7S |
| Molecular Weight | 615.26 g/mol |
| Exact Mass | 612.92 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-7-[[2-(5-bromofuran-2-yl)acetyl]amino]-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Cc1ccc(Br)o1)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(CBr)CS[C@@H]12 |
| InChI | InChI=1S/C21H17Br2N3O7S/c22-8-12-10-34-20-17(24-16(27)7-14-5-6-15(23)33-14)19(28)25(20)18(12)21(29)32-9-11-1-3-13(4-2-11)26(30)31/h1-6,17,20H,7-10H2,(H,24,27)/t17?,20-/m0/s1 |
| InChIKey | FDPVUJJXVBIXMC-OZBJMMHXSA-N |
| XLogP | 3.29 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|