C12H16N2O2 — CID 154007427
1-hydroxy-4,4-dimethyl-1-(6-methylpyrimidin-4-yl)pent-1-en-3-one (PubChem CID 154007427) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-hydroxy-4,4-dimethyl-1-(6-methylpyrimidin-4-yl)pent-1-en-3-one.
| Compound Name | 1-hydroxy-4,4-dimethyl-1-(6-methylpyrimidin-4-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 154007427 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-hydroxy-4,4-dimethyl-1-(6-methylpyrimidin-4-yl)pent-1-en-3-one |
| SMILES | Cc1cc(C(O)=CC(=O)C(C)(C)C)ncn1 |
| InChI | InChI=1S/C12H16N2O2/c1-8-5-9(14-7-13-8)10(15)6-11(16)12(2,3)4/h5-7,15H,1-4H3 |
| InChIKey | HGKLCPLWRQQWNM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|