C21H29NO7 — CID 154009014
(5S)-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxo-2-(phenylmethoxycarbonylamino)heptanoic acid (PubChem CID 154009014) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is (5S)-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxo-2-(phenylmethoxycarbonylamino)heptanoic acid.
| Compound Name | (5S)-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxo-2-(phenylmethoxycarbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 154009014 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (5S)-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxo-2-(phenylmethoxycarbonylamino)heptanoic acid |
| SMILES | CC(C)[C@@H](C(=O)CC(NC(=O)OCc1ccccc1)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29NO7/c1-13(2)17(19(26)29-21(3,4)5)16(23)11-15(18(24)25)22-20(27)28-12-14-9-7-6-8-10-14/h6-10,13,15,17H,11-12H2,1-5H3,(H,22,27)(H,24,25)/t15?,17-/m0/s1 |
| InChIKey | HGFMUQWFQPAKAD-LWKPJOBUSA-N |
| XLogP | 2.94 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|