C10H8F3NO3 — CID 15402071
(E)-1,1,1-trifluoro-4-(4-nitrophenyl)but-3-en-2-ol (PubChem CID 15402071) has the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-(4-nitrophenyl)but-3-en-2-ol.
| Compound Name | (E)-1,1,1-trifluoro-4-(4-nitrophenyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 15402071 |
| Molecular Formula | C10H8F3NO3 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-(4-nitrophenyl)but-3-en-2-ol |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F3NO3/c11-10(12,13)9(15)6-3-7-1-4-8(5-2-7)14(16)17/h1-6,9,15H/b6-3+ |
| InChIKey | OGDAJAPGMPEAHM-ZZXKWVIFSA-N |
| XLogP | 2.53 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|