C22H32O5Si — CID 154021156
(2-cyclohexyl-1,1-dimethoxyethoxy)-dimethoxy-naphthalen-1-ylsilane (PubChem CID 154021156) has the molecular formula C22H32O5Si and a molecular weight of 404.58 g/mol. Its IUPAC name is (2-cyclohexyl-1,1-dimethoxyethoxy)-dimethoxy-naphthalen-1-ylsilane.
| Compound Name | (2-cyclohexyl-1,1-dimethoxyethoxy)-dimethoxy-naphthalen-1-ylsilane |
|---|---|
| PubChem CID | 154021156 |
| Molecular Formula | C22H32O5Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (2-cyclohexyl-1,1-dimethoxyethoxy)-dimethoxy-naphthalen-1-ylsilane |
| SMILES | COC(CC1CCCCC1)(OC)O[Si](OC)(OC)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H32O5Si/c1-23-22(24-2,17-18-11-6-5-7-12-18)27-28(25-3,26-4)21-16-10-14-19-13-8-9-15-20(19)21/h8-10,13-16,18H,5-7,11-12,17H2,1-4H3 |
| InChIKey | UQVLMNYZOCDLOU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|