C25H28F3NO6S — CID 154022581
[(1S,2S,6R,14R,15S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-16-yl] trifluoromethanesulfonate (PubChem CID 154022581) has the molecular formula C25H28F3NO6S and a molecular weight of 527.56 g/mol. Its IUPAC name is [(1S,2S,6R,14R,15S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-16-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,2S,6R,14R,15S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-16-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154022581 |
| Molecular Formula | C25H28F3NO6S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | [(1S,2S,6R,14R,15S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-16-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc2c3c1O[C@@H]1[C@]34CCN(CC3CC3)[C@H](C2)[C@@]42C=C(OS(=O)(=O)C(F)(F)F)[C@]1(OC)CC2 |
| InChI | InChI=1S/C25H28F3NO6S/c1-32-16-6-5-15-11-17-22-7-8-24(33-2,18(12-22)35-36(30,31)25(26,27)28)21-23(22,19(15)20(16)34-21)9-10-29(17)13-14-3-4-14/h5-6,12,14,17,21H,3-4,7-11,13H2,1-2H3/t17-,21-,22-,23+,24-/m1/s1 |
| InChIKey | VZXYUGFCIXQVCN-PBBBXTDZSA-N |
| XLogP | 3.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|