About 4-(1,2,2-tripyridin-4-ylethenyl)pyridine
4-(1,2,2-tripyridin-4-ylethenyl)pyridine (PubChem CID 154027543) has the molecular formula C22H16N4
and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-(1,2,2-tripyridin-4-ylethenyl)pyridine.
Molecular Properties
| Compound Name | 4-(1,2,2-tripyridin-4-ylethenyl)pyridine |
| PubChem CID | 154027543 |
| Molecular Formula | C22H16N4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-(1,2,2-tripyridin-4-ylethenyl)pyridine |
| SMILES | c1cc(C(=C(c2ccncc2)c2ccncc2)c2ccncc2)ccn1 |
| InChI | InChI=1S/C22H16N4/c1-9-23-10-2-17(1)21(18-3-11-24-12-4-18)22(19-5-13-25-14-6-19)20-7-15-26-16-8-20/h1-16H |
| InChIKey | ZTIDKYAFTJKSNT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,2,2-tripyridin-4-ylethenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,2-tripyridin-4-ylethenyl)pyridine?
The IUPAC name of 4-(1,2,2-tripyridin-4-ylethenyl)pyridine (CID 154027543) is 4-(1,2,2-tripyridin-4-ylethenyl)pyridine.
What is the SMILES notation for 4-(1,2,2-tripyridin-4-ylethenyl)pyridine?
The canonical SMILES for 4-(1,2,2-tripyridin-4-ylethenyl)pyridine is c1cc(C(=C(c2ccncc2)c2ccncc2)c2ccncc2)ccn1.
What is the InChIKey of 4-(1,2,2-tripyridin-4-ylethenyl)pyridine?
The InChIKey is ZTIDKYAFTJKSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4/c1-9-23-10-2-17(1)21(18-3-11-24-12-4-18)22(19-5-13-25-14-6-19)20-7-15-26-16-8-20/h1-16H.
What are the key properties of 4-(1,2,2-tripyridin-4-ylethenyl)pyridine?
4-(1,2,2-tripyridin-4-ylethenyl)pyridine has a molecular weight of 336.40 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,2-tripyridin-4-ylethenyl)pyridine is sourced from PubChem (CID 154027543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).