C15H7ClF4N2O2 — CID 154027625
6-chloro-2-[5-fluoro-2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-1-carboxylic acid (PubChem CID 154027625) has the molecular formula C15H7ClF4N2O2 and a molecular weight of 358.68 g/mol. Its IUPAC name is 6-chloro-2-[5-fluoro-2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-1-carboxylic acid.
| Compound Name | 6-chloro-2-[5-fluoro-2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 154027625 |
| Molecular Formula | C15H7ClF4N2O2 |
| Molecular Weight | 358.68 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 6-chloro-2-[5-fluoro-2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-1-carboxylic acid |
| SMILES | O=C(O)n1c(-c2cc(F)ccc2C(F)(F)F)cc2ccc(Cl)nc21 |
| InChI | InChI=1S/C15H7ClF4N2O2/c16-12-4-1-7-5-11(22(14(23)24)13(7)21-12)9-6-8(17)2-3-10(9)15(18,19)20/h1-6H,(H,23,24) |
| InChIKey | GHMDAPUKBHATGU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|