C19H15ClF4N2O2 — CID 142408790
tert-butyl 6-chloro-2-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-1-carboxylate (PubChem CID 142408790) has the molecular formula C19H15ClF4N2O2 and a molecular weight of 414.79 g/mol. Its IUPAC name is tert-butyl 6-chloro-2-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-chloro-2-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 142408790 |
| Molecular Formula | C19H15ClF4N2O2 |
| Molecular Weight | 414.79 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | tert-butyl 6-chloro-2-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccc(F)cc2C(F)(F)F)cc2ccc(Cl)nc21 |
| InChI | InChI=1S/C19H15ClF4N2O2/c1-18(2,3)28-17(27)26-14(8-10-4-7-15(20)25-16(10)26)12-6-5-11(21)9-13(12)19(22,23)24/h4-9H,1-3H3 |
| InChIKey | QATBEMTZTYPIMD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.79 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|