C19H16ClF3N2O2 — CID 172798309
tert-butyl 6-chloro-1-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 172798309) has the molecular formula C19H16ClF3N2O2 and a molecular weight of 396.80 g/mol. Its IUPAC name is tert-butyl 6-chloro-1-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-2-carboxylate.
| Compound Name | tert-butyl 6-chloro-1-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 172798309 |
| Molecular Formula | C19H16ClF3N2O2 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | tert-butyl 6-chloro-1-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc2ccc(Cl)nc2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16ClF3N2O2/c1-18(2,3)27-17(26)14-9-11-7-8-15(20)24-16(11)25(14)13-6-4-5-12(10-13)19(21,22)23/h4-10H,1-3H3 |
| InChIKey | QMVWJHXGHOLMNL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|