C14H10ClF3N4O2 — CID 57498908
8-chloro-1,3-dimethyl-7-[3-(trifluoromethyl)phenyl]purine-2,6-dione (PubChem CID 57498908) has the molecular formula C14H10ClF3N4O2 and a molecular weight of 358.71 g/mol. Its IUPAC name is 8-chloro-1,3-dimethyl-7-[3-(trifluoromethyl)phenyl]purine-2,6-dione.
| Compound Name | 8-chloro-1,3-dimethyl-7-[3-(trifluoromethyl)phenyl]purine-2,6-dione |
|---|---|
| PubChem CID | 57498908 |
| Molecular Formula | C14H10ClF3N4O2 |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 8-chloro-1,3-dimethyl-7-[3-(trifluoromethyl)phenyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Cl)n2-c2cccc(C(F)(F)F)c2)n(C)c1=O |
| InChI | InChI=1S/C14H10ClF3N4O2/c1-20-10-9(11(23)21(2)13(20)24)22(12(15)19-10)8-5-3-4-7(6-8)14(16,17)18/h3-6H,1-2H3 |
| InChIKey | KNEOVAXFIJBEED-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |