C20H15ClF3N5O3 — CID 90403782
7-[(2-chloro-4-pyridinyl)methyl]-1,3-dimethyl-8-[3-(trifluoromethyl)phenoxy]purine-2,6-dione (PubChem CID 90403782) has the molecular formula C20H15ClF3N5O3 and a molecular weight of 465.82 g/mol. Its IUPAC name is 7-[(2-chloro-4-pyridinyl)methyl]-1,3-dimethyl-8-[3-(trifluoromethyl)phenoxy]purine-2,6-dione.
| Compound Name | 7-[(2-chloro-4-pyridinyl)methyl]-1,3-dimethyl-8-[3-(trifluoromethyl)phenoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 90403782 |
| Molecular Formula | C20H15ClF3N5O3 |
| Molecular Weight | 465.82 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 7-[(2-chloro-4-pyridinyl)methyl]-1,3-dimethyl-8-[3-(trifluoromethyl)phenoxy]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Oc3cccc(C(F)(F)F)c3)n2Cc2ccnc(Cl)c2)n(C)c1=O |
| InChI | InChI=1S/C20H15ClF3N5O3/c1-27-16-15(17(30)28(2)19(27)31)29(10-11-6-7-25-14(21)8-11)18(26-16)32-13-5-3-4-12(9-13)20(22,23)24/h3-9H,10H2,1-2H3 |
| InChIKey | LDNWYHAZCWBEHC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.82 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|