C25H25F3N4O5 — CID 162593371
1-[2-(2-hydroxyethoxy)ethyl]-3-methyl-7-[(4-methylphenyl)methyl]-8-[3-(trifluoromethyl)phenoxy]purine-2,6-dione (PubChem CID 162593371) has the molecular formula C25H25F3N4O5 and a molecular weight of 518.49 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]-3-methyl-7-[(4-methylphenyl)methyl]-8-[3-(trifluoromethyl)phenoxy]purine-2,6-dione.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]-3-methyl-7-[(4-methylphenyl)methyl]-8-[3-(trifluoromethyl)phenoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 162593371 |
| Molecular Formula | C25H25F3N4O5 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]-3-methyl-7-[(4-methylphenyl)methyl]-8-[3-(trifluoromethyl)phenoxy]purine-2,6-dione |
| SMILES | Cc1ccc(Cn2c(Oc3cccc(C(F)(F)F)c3)nc3c2c(=O)n(CCOCCO)c(=O)n3C)cc1 |
| InChI | InChI=1S/C25H25F3N4O5/c1-16-6-8-17(9-7-16)15-32-20-21(30(2)24(35)31(22(20)34)10-12-36-13-11-33)29-23(32)37-19-5-3-4-18(14-19)25(26,27)28/h3-9,14,33H,10-13,15H2,1-2H3 |
| InChIKey | BYOUMRCQVKZFHY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|