C17H14Cl2F6N2O2 — CID 158329237
tert-butyl 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylate;2-chloro-6-(trifluoromethyl)pyridine (PubChem CID 158329237) has the molecular formula C17H14Cl2F6N2O2 and a molecular weight of 463.21 g/mol. Its IUPAC name is tert-butyl 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylate;2-chloro-6-(trifluoromethyl)pyridine.
| Compound Name | tert-butyl 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylate;2-chloro-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 158329237 |
| Molecular Formula | C17H14Cl2F6N2O2 |
| Molecular Weight | 463.21 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | tert-butyl 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylate;2-chloro-6-(trifluoromethyl)pyridine |
| SMILES | CC(C)(C)OC(=O)c1cc(Cl)nc(C(F)(F)F)c1.FC(F)(F)c1cccc(Cl)n1 |
| InChI | InChI=1S/C11H11ClF3NO2.C6H3ClF3N/c1-10(2,3)18-9(17)6-4-7(11(13,14)15)16-8(12)5-6;7-5-3-1-2-4(11-5)6(8,9)10/h4-5H,1-3H3;1-3H |
| InChIKey | GPUKWNWIFQCYJM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.21 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|