C13H6Cl2F6N2O2 — CID 158174130
2-chloro-6-(trifluoromethyl)pyridine;2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid (PubChem CID 158174130) has the molecular formula C13H6Cl2F6N2O2 and a molecular weight of 407.10 g/mol. Its IUPAC name is 2-chloro-6-(trifluoromethyl)pyridine;2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(trifluoromethyl)pyridine;2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 158174130 |
| Molecular Formula | C13H6Cl2F6N2O2 |
| Molecular Weight | 407.10 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 2-chloro-6-(trifluoromethyl)pyridine;2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid |
| SMILES | FC(F)(F)c1cccc(Cl)n1.O=C(O)c1cc(Cl)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H3ClF3NO2.C6H3ClF3N/c8-5-2-3(6(13)14)1-4(12-5)7(9,10)11;7-5-3-1-2-4(11-5)6(8,9)10/h1-2H,(H,13,14);1-3H |
| InChIKey | FXULGPVJFPFOAT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.10 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|