C8H4F3NO4 — CID 130114973
6-(trifluoromethyl)pyridine-2,4-dicarboxylic acid (PubChem CID 130114973) has the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. Its IUPAC name is 6-(trifluoromethyl)pyridine-2,4-dicarboxylic acid.
| Compound Name | 6-(trifluoromethyl)pyridine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 130114973 |
| Molecular Formula | C8H4F3NO4 |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 6-(trifluoromethyl)pyridine-2,4-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4F3NO4/c9-8(10,11)5-2-3(6(13)14)1-4(12-5)7(15)16/h1-2H,(H,13,14)(H,15,16) |
| InChIKey | NFUZPTYUYMCJCW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |