C11H13F3N2O2 — CID 165493421
2-(tert-butylamino)-6-(trifluoromethyl)pyridine-4-carboxylic acid (PubChem CID 165493421) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 2-(tert-butylamino)-6-(trifluoromethyl)pyridine-4-carboxylic acid.
| Compound Name | 2-(tert-butylamino)-6-(trifluoromethyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 165493421 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-(tert-butylamino)-6-(trifluoromethyl)pyridine-4-carboxylic acid |
| SMILES | CC(C)(C)Nc1cc(C(=O)O)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-10(2,3)16-8-5-6(9(17)18)4-7(15-8)11(12,13)14/h4-5H,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | LDHSMBMIVOGNFM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |