C18H10ClF3N4O2 — CID 88850373
methyl 7-chloro-2-[3-(trifluoromethyl)phenyl]triazolo[4,5-f]quinoline-9-carboxylate (PubChem CID 88850373) has the molecular formula C18H10ClF3N4O2 and a molecular weight of 406.75 g/mol. Its IUPAC name is methyl 7-chloro-2-[3-(trifluoromethyl)phenyl]triazolo[4,5-f]quinoline-9-carboxylate.
| Compound Name | methyl 7-chloro-2-[3-(trifluoromethyl)phenyl]triazolo[4,5-f]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 88850373 |
| Molecular Formula | C18H10ClF3N4O2 |
| Molecular Weight | 406.75 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | methyl 7-chloro-2-[3-(trifluoromethyl)phenyl]triazolo[4,5-f]quinoline-9-carboxylate |
| SMILES | COC(=O)c1cc(Cl)nc2ccc3nn(-c4cccc(C(F)(F)F)c4)nc3c12 |
| InChI | InChI=1S/C18H10ClF3N4O2/c1-28-17(27)11-8-14(19)23-12-5-6-13-16(15(11)12)25-26(24-13)10-4-2-3-9(7-10)18(20,21)22/h2-8H,1H3 |
| InChIKey | OUSRNZZQWOZVEH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.75 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|