C20H19ClF2N2O2 — CID 172845909
tert-butyl 6-chloro-1-[2-(difluoromethyl)-3-methylphenyl]pyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 172845909) has the molecular formula C20H19ClF2N2O2 and a molecular weight of 392.83 g/mol. Its IUPAC name is tert-butyl 6-chloro-1-[2-(difluoromethyl)-3-methylphenyl]pyrrolo[2,3-b]pyridine-2-carboxylate.
| Compound Name | tert-butyl 6-chloro-1-[2-(difluoromethyl)-3-methylphenyl]pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 172845909 |
| Molecular Formula | C20H19ClF2N2O2 |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | tert-butyl 6-chloro-1-[2-(difluoromethyl)-3-methylphenyl]pyrrolo[2,3-b]pyridine-2-carboxylate |
| SMILES | Cc1cccc(-n2c(C(=O)OC(C)(C)C)cc3ccc(Cl)nc32)c1C(F)F |
| InChI | InChI=1S/C20H19ClF2N2O2/c1-11-6-5-7-13(16(11)17(22)23)25-14(19(26)27-20(2,3)4)10-12-8-9-15(21)24-18(12)25/h5-10,17H,1-4H3 |
| InChIKey | XKMMAOJYKZBZPK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|