C20H18ClF2N3O3 — CID 89314738
tert-butyl N-[5-(7-chloro-2-methyl-4-oxo-1,8-naphthyridin-1-yl)-2,4-difluorophenyl]carbamate (PubChem CID 89314738) has the molecular formula C20H18ClF2N3O3 and a molecular weight of 421.83 g/mol. Its IUPAC name is tert-butyl N-[5-(7-chloro-2-methyl-4-oxo-1,8-naphthyridin-1-yl)-2,4-difluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-(7-chloro-2-methyl-4-oxo-1,8-naphthyridin-1-yl)-2,4-difluorophenyl]carbamate |
|---|---|
| PubChem CID | 89314738 |
| Molecular Formula | C20H18ClF2N3O3 |
| Molecular Weight | 421.83 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | tert-butyl N-[5-(7-chloro-2-methyl-4-oxo-1,8-naphthyridin-1-yl)-2,4-difluorophenyl]carbamate |
| SMILES | Cc1cc(=O)c2ccc(Cl)nc2n1-c1cc(NC(=O)OC(C)(C)C)c(F)cc1F |
| InChI | InChI=1S/C20H18ClF2N3O3/c1-10-7-16(27)11-5-6-17(21)25-18(11)26(10)15-9-14(12(22)8-13(15)23)24-19(28)29-20(2,3)4/h5-9H,1-4H3,(H,24,28) |
| InChIKey | TZWMIHQBOXIVEA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.83 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|