C17H20F4N2O3 — CID 141457664
tert-butyl 3-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]azetidine-1-carboxylate (PubChem CID 141457664) has the molecular formula C17H20F4N2O3 and a molecular weight of 376.35 g/mol. Its IUPAC name is tert-butyl 3-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 141457664 |
| Molecular Formula | C17H20F4N2O3 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | tert-butyl 3-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]azetidine-1-carboxylate |
| SMILES | CN(C(=O)c1ccc(F)cc1C(F)(F)F)C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H20F4N2O3/c1-16(2,3)26-15(25)23-8-11(9-23)22(4)14(24)12-6-5-10(18)7-13(12)17(19,20)21/h5-7,11H,8-9H2,1-4H3 |
| InChIKey | CGBWXFYMLVHXLV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |