C18H18F4N2O3 — CID 141457669
tert-butyl 3-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]pyrrole-1-carboxylate (PubChem CID 141457669) has the molecular formula C18H18F4N2O3 and a molecular weight of 386.35 g/mol. Its IUPAC name is tert-butyl 3-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 141457669 |
| Molecular Formula | C18H18F4N2O3 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | tert-butyl 3-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]pyrrole-1-carboxylate |
| SMILES | CN(C(=O)c1ccc(F)cc1C(F)(F)F)c1ccn(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H18F4N2O3/c1-17(2,3)27-16(26)24-8-7-12(10-24)23(4)15(25)13-6-5-11(19)9-14(13)18(20,21)22/h5-10H,1-4H3 |
| InChIKey | WPFGNWVVSPXSOA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |