C11H9F4O4P-2 — CID 151049471
1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-2-phosphonatopropan-1-one (PubChem CID 151049471) has the molecular formula C11H9F4O4P-2 and a molecular weight of 312.16 g/mol. Its IUPAC name is 1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-2-phosphonatopropan-1-one.
| Compound Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-2-phosphonatopropan-1-one |
|---|---|
| PubChem CID | 151049471 |
| Molecular Formula | C11H9F4O4P-2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-2-phosphonatopropan-1-one |
| SMILES | CC(C)(C(=O)c1ccc(F)cc1C(F)(F)F)P(=O)([O-])[O-] |
| InChI | InChI=1S/C11H11F4O4P/c1-10(2,20(17,18)19)9(16)7-4-3-6(12)5-8(7)11(13,14)15/h3-5H,1-2H3,(H2,17,18,19)/p-2 |
| InChIKey | MDURWJPIUZXCQK-UHFFFAOYSA-L |
| XLogP | 1.72 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|