C22H24FN7O — CID 154030044
6-[(2-aminocyclohexylidene)amino]-5-fluoro-2-[[8-(methylamino)quinolin-6-yl]amino]pyridine-3-carboxamide (PubChem CID 154030044) has the molecular formula C22H24FN7O and a molecular weight of 421.48 g/mol. Its IUPAC name is 6-[(2-aminocyclohexylidene)amino]-5-fluoro-2-[[8-(methylamino)quinolin-6-yl]amino]pyridine-3-carboxamide.
| Compound Name | 6-[(2-aminocyclohexylidene)amino]-5-fluoro-2-[[8-(methylamino)quinolin-6-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154030044 |
| Molecular Formula | C22H24FN7O |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 6-[(2-aminocyclohexylidene)amino]-5-fluoro-2-[[8-(methylamino)quinolin-6-yl]amino]pyridine-3-carboxamide |
| SMILES | CNc1cc(Nc2nc(N=C3CCCCC3N)c(F)cc2C(N)=O)cc2cccnc12 |
| InChI | InChI=1S/C22H24FN7O/c1-26-18-10-13(9-12-5-4-8-27-19(12)18)28-21-14(20(25)31)11-15(23)22(30-21)29-17-7-3-2-6-16(17)24/h4-5,8-11,16,26H,2-3,6-7,24H2,1H3,(H2,25,31)(H,28,30) |
| InChIKey | CJUIEEQJZGLQFF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|