C18H21F3N6O5 — CID 154033374
[[amino-[4-[3-(morpholin-4-ylmethyl)azetidin-1-yl]-2,1,3-benzoxadiazol-6-yl]methylidene]amino] 3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 154033374) has the molecular formula C18H21F3N6O5 and a molecular weight of 458.40 g/mol. Its IUPAC name is [[amino-[4-[3-(morpholin-4-ylmethyl)azetidin-1-yl]-2,1,3-benzoxadiazol-6-yl]methylidene]amino] 3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | [[amino-[4-[3-(morpholin-4-ylmethyl)azetidin-1-yl]-2,1,3-benzoxadiazol-6-yl]methylidene]amino] 3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 154033374 |
| Molecular Formula | C18H21F3N6O5 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [[amino-[4-[3-(morpholin-4-ylmethyl)azetidin-1-yl]-2,1,3-benzoxadiazol-6-yl]methylidene]amino] 3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | NC(=NOC(=O)C(O)C(F)(F)F)c1cc(N2CC(CN3CCOCC3)C2)c2nonc2c1 |
| InChI | InChI=1S/C18H21F3N6O5/c19-18(20,21)15(28)17(29)31-25-16(22)11-5-12-14(24-32-23-12)13(6-11)27-8-10(9-27)7-26-1-3-30-4-2-26/h5-6,10,15,28H,1-4,7-9H2,(H2,22,25) |
| InChIKey | WIHPUUHCWSKJNR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|