C16H17ClF2N6 — CID 154040530
12-chloro-13-[3-(2,2-difluoroethylamino)pyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-4-amine (PubChem CID 154040530) has the molecular formula C16H17ClF2N6 and a molecular weight of 366.80 g/mol. Its IUPAC name is 12-chloro-13-[3-(2,2-difluoroethylamino)pyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-4-amine.
| Compound Name | 12-chloro-13-[3-(2,2-difluoroethylamino)pyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-4-amine |
|---|---|
| PubChem CID | 154040530 |
| Molecular Formula | C16H17ClF2N6 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 12-chloro-13-[3-(2,2-difluoroethylamino)pyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-4-amine |
| SMILES | Nc1cc2c(cn1)[nH]c1ncc(Cl)c(N3CCC(NCC(F)F)C3)c12 |
| InChI | InChI=1S/C16H17ClF2N6/c17-10-4-23-16-14(9-3-13(20)22-5-11(9)24-16)15(10)25-2-1-8(7-25)21-6-12(18)19/h3-5,8,12,21H,1-2,6-7H2,(H2,20,22)(H,23,24) |
| InChIKey | QWLPFRBBYGGWAO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |