C13H16N4O3S — CID 154044520
ethyl 2-[[amino-(pent-4-ynoylamino)methylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 154044520) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is ethyl 2-[[amino-(pent-4-ynoylamino)methylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[amino-(pent-4-ynoylamino)methylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 154044520 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | ethyl 2-[[amino-(pent-4-ynoylamino)methylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C#CCCC(=O)NC(N)=Nc1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C13H16N4O3S/c1-4-6-7-9(18)16-12(14)17-13-15-8(3)10(21-13)11(19)20-5-2/h1H,5-7H2,2-3H3,(H3,14,15,16,17,18) |
| InChIKey | PKMZVKZEEHEWKW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|