C33H33F3N6O2S — CID 154046427
1-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]urea (PubChem CID 154046427) has the molecular formula C33H33F3N6O2S and a molecular weight of 634.73 g/mol. Its IUPAC name is 1-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]urea.
| Compound Name | 1-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]urea |
|---|---|
| PubChem CID | 154046427 |
| Molecular Formula | C33H33F3N6O2S |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | 1-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]urea |
| SMILES | Cc1cc(C)c(N2C(=NC(=O)NC3CC3c3ccc(-c4ncn(-c5ccc(OC(F)(F)F)cc5)n4)cc3)SCCC2C)c(C)c1 |
| InChI | InChI=1S/C33H33F3N6O2S/c1-19-15-20(2)29(21(3)16-19)42-22(4)13-14-45-32(42)39-31(43)38-28-17-27(28)23-5-7-24(8-6-23)30-37-18-41(40-30)25-9-11-26(12-10-25)44-33(34,35)36/h5-12,15-16,18,22,27-28H,13-14,17H2,1-4H3,(H,38,43) |
| InChIKey | AHALGXRHURGSKW-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|