C27H28ClN5O3S — CID 154052632
2-[(4-chlorophenyl)carbamoylamino]-6-[3-(3-phenylprop-2-enoylamino)propyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 154052632) has the molecular formula C27H28ClN5O3S and a molecular weight of 538.07 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-6-[3-(3-phenylprop-2-enoylamino)propyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-6-[3-(3-phenylprop-2-enoylamino)propyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154052632 |
| Molecular Formula | C27H28ClN5O3S |
| Molecular Weight | 538.07 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-6-[3-(3-phenylprop-2-enoylamino)propyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)Nc2ccc(Cl)cc2)sc2c1CCN(CCCNC(=O)C=Cc1ccccc1)C2 |
| InChI | InChI=1S/C27H28ClN5O3S/c28-19-8-10-20(11-9-19)31-27(36)32-26-24(25(29)35)21-13-16-33(17-22(21)37-26)15-4-14-30-23(34)12-7-18-5-2-1-3-6-18/h1-3,5-12H,4,13-17H2,(H2,29,35)(H,30,34)(H2,31,32,36) |
| InChIKey | KOBQFDATGACEIZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.07 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|