C30H31ClN6O3S — CID 160517005
2-[(4-chlorophenyl)carbamoylamino]-6-(5-oxo-7-quinoxalin-2-ylheptyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 160517005) has the molecular formula C30H31ClN6O3S and a molecular weight of 591.14 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-6-(5-oxo-7-quinoxalin-2-ylheptyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-6-(5-oxo-7-quinoxalin-2-ylheptyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 160517005 |
| Molecular Formula | C30H31ClN6O3S |
| Molecular Weight | 591.14 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-6-(5-oxo-7-quinoxalin-2-ylheptyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)Nc2ccc(Cl)cc2)sc2c1CCN(CCCCC(=O)CCc1cnc3ccccc3n1)C2 |
| InChI | InChI=1S/C30H31ClN6O3S/c31-19-8-10-20(11-9-19)35-30(40)36-29-27(28(32)39)23-14-16-37(18-26(23)41-29)15-4-3-5-22(38)13-12-21-17-33-24-6-1-2-7-25(24)34-21/h1-2,6-11,17H,3-5,12-16,18H2,(H2,32,39)(H2,35,36,40) |
| InChIKey | KJUHXQOFKXFSLY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.14 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|