C26H24N4O4 — CID 154055651
N-benzyl-5-cyclobutyl-3-[4-(furan-2-carbonylamino)-2-hydroxyphenyl]pyrazole-1-carboxamide (PubChem CID 154055651) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-benzyl-5-cyclobutyl-3-[4-(furan-2-carbonylamino)-2-hydroxyphenyl]pyrazole-1-carboxamide.
| Compound Name | N-benzyl-5-cyclobutyl-3-[4-(furan-2-carbonylamino)-2-hydroxyphenyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154055651 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-benzyl-5-cyclobutyl-3-[4-(furan-2-carbonylamino)-2-hydroxyphenyl]pyrazole-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cc(C3CCC3)n(C(=O)NCc3ccccc3)n2)c(O)c1)c1ccco1 |
| InChI | InChI=1S/C26H24N4O4/c31-23-14-19(28-25(32)24-10-5-13-34-24)11-12-20(23)21-15-22(18-8-4-9-18)30(29-21)26(33)27-16-17-6-2-1-3-7-17/h1-3,5-7,10-15,18,31H,4,8-9,16H2,(H,27,33)(H,28,32) |
| InChIKey | UXTQCABJIYEQAX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |