C14H14F4NO3- — CID 154056222
4-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 154056222) has the molecular formula C14H14F4NO3- and a molecular weight of 320.26 g/mol. Its IUPAC name is 4-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | 4-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154056222 |
| Molecular Formula | C14H14F4NO3- |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(c2ccc(F)c(C(F)(F)F)c2)C(CO)C1 |
| InChI | InChI=1S/C14H15F4NO3/c15-12-2-1-8(5-11(12)14(16,17)18)10-3-4-19(13(21)22)6-9(10)7-20/h1-2,5,9-10,20H,3-4,6-7H2,(H,21,22)/p-1 |
| InChIKey | SQVSGUGCBBPTIS-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |