C28H28F2N4O4 — CID 154056566
(1R,3aR,6S,7R,7aS)-N'-acetyl-7-[2-[5-(2-cyano-3-methylphenyl)-2-pyridinyl]ethenyl]-5,5-difluoro-1,6-dimethyl-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carbohydrazide (PubChem CID 154056566) has the molecular formula C28H28F2N4O4 and a molecular weight of 522.55 g/mol. Its IUPAC name is (1R,3aR,6S,7R,7aS)-N'-acetyl-7-[2-[5-(2-cyano-3-methylphenyl)-2-pyridinyl]ethenyl]-5,5-difluoro-1,6-dimethyl-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carbohydrazide.
| Compound Name | (1R,3aR,6S,7R,7aS)-N'-acetyl-7-[2-[5-(2-cyano-3-methylphenyl)-2-pyridinyl]ethenyl]-5,5-difluoro-1,6-dimethyl-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carbohydrazide |
|---|---|
| PubChem CID | 154056566 |
| Molecular Formula | C28H28F2N4O4 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (1R,3aR,6S,7R,7aS)-N'-acetyl-7-[2-[5-(2-cyano-3-methylphenyl)-2-pyridinyl]ethenyl]-5,5-difluoro-1,6-dimethyl-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carbohydrazide |
| SMILES | CC(=O)NNC(=O)[C@@]12CC(F)(F)[C@@H](C)[C@H](C=Cc3ccc(-c4cccc(C)c4C#N)cn3)[C@@H]1[C@@H](C)OC2=O |
| InChI | InChI=1S/C28H28F2N4O4/c1-15-6-5-7-22(23(15)12-31)19-8-9-20(32-13-19)10-11-21-16(2)28(29,30)14-27(25(36)34-33-18(4)35)24(21)17(3)38-26(27)37/h5-11,13,16-17,21,24H,14H2,1-4H3,(H,33,35)(H,34,36)/t16-,17+,21-,24-,27+/m0/s1 |
| InChIKey | HXLJPEFGKPGPAK-MCELDGGOSA-N |
| XLogP | 3.95 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|