C23H20N2O — CID 154056698
1-phenyl-4-(2,4,6-trimethylphenoxy)phthalazine (PubChem CID 154056698) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-phenyl-4-(2,4,6-trimethylphenoxy)phthalazine.
| Compound Name | 1-phenyl-4-(2,4,6-trimethylphenoxy)phthalazine |
|---|---|
| PubChem CID | 154056698 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-phenyl-4-(2,4,6-trimethylphenoxy)phthalazine |
| SMILES | Cc1cc(C)c(Oc2nnc(-c3ccccc3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C23H20N2O/c1-15-13-16(2)22(17(3)14-15)26-23-20-12-8-7-11-19(20)21(24-25-23)18-9-5-4-6-10-18/h4-14H,1-3H3 |
| InChIKey | MXBPGYQJSPGSHX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |