C23H17N2O3- — CID 7109213
3-[4-(3,4-dimethylphenyl)phthalazin-1-yl]oxybenzoate (PubChem CID 7109213) has the molecular formula C23H17N2O3- and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-[4-(3,4-dimethylphenyl)phthalazin-1-yl]oxybenzoate.
| Compound Name | 3-[4-(3,4-dimethylphenyl)phthalazin-1-yl]oxybenzoate |
|---|---|
| PubChem CID | 7109213 |
| Molecular Formula | C23H17N2O3- |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[4-(3,4-dimethylphenyl)phthalazin-1-yl]oxybenzoate |
| SMILES | Cc1ccc(-c2nnc(Oc3cccc(C(=O)[O-])c3)c3ccccc23)cc1C |
| InChI | InChI=1S/C23H18N2O3/c1-14-10-11-16(12-15(14)2)21-19-8-3-4-9-20(19)22(25-24-21)28-18-7-5-6-17(13-18)23(26)27/h3-13H,1-2H3,(H,26,27)/p-1 |
| InChIKey | GUZUFJBFAWYTCC-UHFFFAOYSA-M |
| XLogP | 4.07 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |