C25H30N4O8 — CID 45042443
N-[4-(3,4-dimethylphenyl)phthalazin-1-yl]-N',N'-dimethylpropane-1,3-diamine;oxalic acid (PubChem CID 45042443) has the molecular formula C25H30N4O8 and a molecular weight of 514.54 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)phthalazin-1-yl]-N',N'-dimethylpropane-1,3-diamine;oxalic acid.
| Compound Name | N-[4-(3,4-dimethylphenyl)phthalazin-1-yl]-N',N'-dimethylpropane-1,3-diamine;oxalic acid |
|---|---|
| PubChem CID | 45042443 |
| Molecular Formula | C25H30N4O8 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)phthalazin-1-yl]-N',N'-dimethylpropane-1,3-diamine;oxalic acid |
| SMILES | Cc1ccc(-c2nnc(NCCCN(C)C)c3ccccc23)cc1C.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H26N4.2C2H2O4/c1-15-10-11-17(14-16(15)2)20-18-8-5-6-9-19(18)21(24-23-20)22-12-7-13-25(3)4;2*3-1(4)2(5)6/h5-6,8-11,14H,7,12-13H2,1-4H3,(H,22,24);2*(H,3,4)(H,5,6) |
| InChIKey | UEACKBPYAVSSDO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 190.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|