C19H22N4 — CID 82191602
N'-[4-(2,5-dimethylphenyl)phthalazin-1-yl]propane-1,3-diamine (PubChem CID 82191602) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is N'-[4-(2,5-dimethylphenyl)phthalazin-1-yl]propane-1,3-diamine.
| Compound Name | N'-[4-(2,5-dimethylphenyl)phthalazin-1-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 82191602 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N'-[4-(2,5-dimethylphenyl)phthalazin-1-yl]propane-1,3-diamine |
| SMILES | Cc1ccc(C)c(-c2nnc(NCCCN)c3ccccc23)c1 |
| InChI | InChI=1S/C19H22N4/c1-13-8-9-14(2)17(12-13)18-15-6-3-4-7-16(15)19(23-22-18)21-11-5-10-20/h3-4,6-9,12H,5,10-11,20H2,1-2H3,(H,21,23) |
| InChIKey | BNKNCXFJKQLTTH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|