C17H18N4 — CID 115375506
4-(5-methyl-3-pyridinyl)-N-propylphthalazin-1-amine (PubChem CID 115375506) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-(5-methyl-3-pyridinyl)-N-propylphthalazin-1-amine.
| Compound Name | 4-(5-methyl-3-pyridinyl)-N-propylphthalazin-1-amine |
|---|---|
| PubChem CID | 115375506 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-(5-methyl-3-pyridinyl)-N-propylphthalazin-1-amine |
| SMILES | CCCNc1nnc(-c2cncc(C)c2)c2ccccc12 |
| InChI | InChI=1S/C17H18N4/c1-3-8-19-17-15-7-5-4-6-14(15)16(20-21-17)13-9-12(2)10-18-11-13/h4-7,9-11H,3,8H2,1-2H3,(H,19,21) |
| InChIKey | WJQPTUHTTIZHPL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |