C6H12NO7P — CID 154057194
3-[[carboxymethoxy(hydroxy)phosphoryl]methylamino]propanoic acid (PubChem CID 154057194) has the molecular formula C6H12NO7P and a molecular weight of 241.14 g/mol. Its IUPAC name is 3-[[carboxymethoxy(hydroxy)phosphoryl]methylamino]propanoic acid.
| Compound Name | 3-[[carboxymethoxy(hydroxy)phosphoryl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 154057194 |
| Molecular Formula | C6H12NO7P |
| Molecular Weight | 241.14 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 3-[[carboxymethoxy(hydroxy)phosphoryl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCP(=O)(O)OCC(=O)O |
| InChI | InChI=1S/C6H12NO7P/c8-5(9)1-2-7-4-15(12,13)14-3-6(10)11/h7H,1-4H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | LRBWZRCUQOKDCF-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.14 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|