C15H20O4 — CID 15405998
methyl (E)-2,2-dimethoxy-4-methyl-5-phenylpent-4-enoate (PubChem CID 15405998) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl (E)-2,2-dimethoxy-4-methyl-5-phenylpent-4-enoate.
| Compound Name | methyl (E)-2,2-dimethoxy-4-methyl-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 15405998 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | methyl (E)-2,2-dimethoxy-4-methyl-5-phenylpent-4-enoate |
| SMILES | COC(=O)C(C/C(C)=C/c1ccccc1)(OC)OC |
| InChI | InChI=1S/C15H20O4/c1-12(10-13-8-6-5-7-9-13)11-15(18-3,19-4)14(16)17-2/h5-10H,11H2,1-4H3/b12-10+ |
| InChIKey | XPACSNDZUKNYNB-ZRDIBKRKSA-N |
| XLogP | 2.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|