C26H22F5N7O2S — CID 154062251
5-[[2-[4-[[[6-(2,6-difluoro-4-pyridinyl)-4-(trifluoromethyl)-2-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062251) has the molecular formula C26H22F5N7O2S and a molecular weight of 591.57 g/mol. Its IUPAC name is 5-[[2-[4-[[[6-(2,6-difluoro-4-pyridinyl)-4-(trifluoromethyl)-2-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[[6-(2,6-difluoro-4-pyridinyl)-4-(trifluoromethyl)-2-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062251 |
| Molecular Formula | C26H22F5N7O2S |
| Molecular Weight | 591.57 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | 5-[[2-[4-[[[6-(2,6-difluoro-4-pyridinyl)-4-(trifluoromethyl)-2-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCc4cc(C(F)(F)F)cc(-c5cc(F)nc(F)c5)n4)CC3)n2)S1 |
| InChI | InChI=1S/C26H22F5N7O2S/c27-21-7-15(8-22(28)36-21)19-10-16(26(29,30)31)9-18(34-19)13-32-12-14-2-5-38(6-3-14)24-33-4-1-17(35-24)11-20-23(39)37-25(40)41-20/h1,4,7-11,14,32H,2-3,5-6,12-13H2,(H,37,39,40) |
| InChIKey | YJXDFPURJIMNSP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|