C14H14N2O2 — CID 154066265
2-(cyclopropylmethoxy)quinoline-3-carboxamide (PubChem CID 154066265) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)quinoline-3-carboxamide.
| Compound Name | 2-(cyclopropylmethoxy)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 154066265 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(cyclopropylmethoxy)quinoline-3-carboxamide |
| SMILES | NC(=O)c1cc2ccccc2nc1OCC1CC1 |
| InChI | InChI=1S/C14H14N2O2/c15-13(17)11-7-10-3-1-2-4-12(10)16-14(11)18-8-9-5-6-9/h1-4,7,9H,5-6,8H2,(H2,15,17) |
| InChIKey | VKEXUDGCCKOKQV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |