C18H12ClNO5 — CID 154067926
4-[3-[(2-chloro-6-cyanophenyl)methoxy]phenyl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 154067926) has the molecular formula C18H12ClNO5 and a molecular weight of 357.75 g/mol. Its IUPAC name is 4-[3-[(2-chloro-6-cyanophenyl)methoxy]phenyl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | 4-[3-[(2-chloro-6-cyanophenyl)methoxy]phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 154067926 |
| Molecular Formula | C18H12ClNO5 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-[3-[(2-chloro-6-cyanophenyl)methoxy]phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | N#Cc1cccc(Cl)c1COc1cccc(C(O)=CC(=O)C(=O)O)c1 |
| InChI | InChI=1S/C18H12ClNO5/c19-15-6-2-4-12(9-20)14(15)10-25-13-5-1-3-11(7-13)16(21)8-17(22)18(23)24/h1-8,21H,10H2,(H,23,24) |
| InChIKey | RWBXHMRDUUDTIB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|