C17H17Cl2N2O+ — CID 168886860
[(Z)-3-amino-1-[3-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enylidene]-methylazanium (PubChem CID 168886860) has the molecular formula C17H17Cl2N2O+ and a molecular weight of 336.24 g/mol. Its IUPAC name is [(Z)-3-amino-1-[3-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enylidene]-methylazanium.
| Compound Name | [(Z)-3-amino-1-[3-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enylidene]-methylazanium |
|---|---|
| PubChem CID | 168886860 |
| Molecular Formula | C17H17Cl2N2O+ |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | [(Z)-3-amino-1-[3-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enylidene]-methylazanium |
| SMILES | C/[NH+]=C(/C=C\N)c1cccc(OCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O/c1-21-17(8-9-20)12-4-2-5-13(10-12)22-11-14-15(18)6-3-7-16(14)19/h2-10H,11,20H2,1H3/p+1/b9-8-,21-17- |
| InChIKey | ZKOWRIPQGMVRPG-MIUZONMXSA-O |
| XLogP | 2.54 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|