C18H16Cl2O2 — CID 142104995
(E)-3-[5-[(2,6-dichlorophenyl)methoxy]-2-methylphenyl]-2-methylprop-2-enal (PubChem CID 142104995) has the molecular formula C18H16Cl2O2 and a molecular weight of 335.23 g/mol. Its IUPAC name is (E)-3-[5-[(2,6-dichlorophenyl)methoxy]-2-methylphenyl]-2-methylprop-2-enal.
| Compound Name | (E)-3-[5-[(2,6-dichlorophenyl)methoxy]-2-methylphenyl]-2-methylprop-2-enal |
|---|---|
| PubChem CID | 142104995 |
| Molecular Formula | C18H16Cl2O2 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (E)-3-[5-[(2,6-dichlorophenyl)methoxy]-2-methylphenyl]-2-methylprop-2-enal |
| SMILES | C/C(C=O)=C\c1cc(OCc2c(Cl)cccc2Cl)ccc1C |
| InChI | InChI=1S/C18H16Cl2O2/c1-12(10-21)8-14-9-15(7-6-13(14)2)22-11-16-17(19)4-3-5-18(16)20/h3-10H,11H2,1-2H3/b12-8+ |
| InChIKey | UKQVFSZSAYOWQE-XYOKQWHBSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|