C18H19ClO2 — CID 87257616
3-chloro-2-[(2,5-dimethylphenoxy)methyl]benzaldehyde;ethene (PubChem CID 87257616) has the molecular formula C18H19ClO2 and a molecular weight of 302.80 g/mol. Its IUPAC name is 3-chloro-2-[(2,5-dimethylphenoxy)methyl]benzaldehyde;ethene.
| Compound Name | 3-chloro-2-[(2,5-dimethylphenoxy)methyl]benzaldehyde;ethene |
|---|---|
| PubChem CID | 87257616 |
| Molecular Formula | C18H19ClO2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-chloro-2-[(2,5-dimethylphenoxy)methyl]benzaldehyde;ethene |
| SMILES | C=C.Cc1ccc(C)c(OCc2c(Cl)cccc2C=O)c1 |
| InChI | InChI=1S/C16H15ClO2.C2H4/c1-11-6-7-12(2)16(8-11)19-10-14-13(9-18)4-3-5-15(14)17;1-2/h3-9H,10H2,1-2H3;1-2H2 |
| InChIKey | XCAZKQPTQNJWOF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|