C22H30O4 — CID 87257546
1,1-diethoxyethane;2-[(2,5-dimethylphenoxy)methyl]benzaldehyde (PubChem CID 87257546) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 1,1-diethoxyethane;2-[(2,5-dimethylphenoxy)methyl]benzaldehyde.
| Compound Name | 1,1-diethoxyethane;2-[(2,5-dimethylphenoxy)methyl]benzaldehyde |
|---|---|
| PubChem CID | 87257546 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1,1-diethoxyethane;2-[(2,5-dimethylphenoxy)methyl]benzaldehyde |
| SMILES | CCOC(C)OCC.Cc1ccc(C)c(OCc2ccccc2C=O)c1 |
| InChI | InChI=1S/C16H16O2.C6H14O2/c1-12-7-8-13(2)16(9-12)18-11-15-6-4-3-5-14(15)10-17;1-4-7-6(3)8-5-2/h3-10H,11H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | AIIVFTSCRIYZLM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|